C23H11F9O3 — CID 160839547
4-[3-[3,5-bis(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enoyl]naphthalene-1-carboxylic acid (PubChem CID 160839547) has the molecular formula C23H11F9O3 and a molecular weight of 506.32 g/mol. Its IUPAC name is 4-[3-[3,5-bis(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enoyl]naphthalene-1-carboxylic acid.
| Compound Name | 4-[3-[3,5-bis(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enoyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 160839547 |
| Molecular Formula | C23H11F9O3 |
| Molecular Weight | 506.32 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 4-[3-[3,5-bis(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enoyl]naphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)C=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C23H11F9O3/c24-21(25,26)12-7-11(8-13(9-12)22(27,28)29)18(23(30,31)32)10-19(33)16-5-6-17(20(34)35)15-4-2-1-3-14(15)16/h1-10H,(H,34,35) |
| InChIKey | OUICSWMHUYDBFO-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.32 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|