C25H16Cl2F6N2O3 — CID 130352601
4-[(Z)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]naphthalene-1-carboxamide (PubChem CID 130352601) has the molecular formula C25H16Cl2F6N2O3 and a molecular weight of 577.31 g/mol. Its IUPAC name is 4-[(Z)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]naphthalene-1-carboxamide.
| Compound Name | 4-[(Z)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 130352601 |
| Molecular Formula | C25H16Cl2F6N2O3 |
| Molecular Weight | 577.31 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | 4-[(Z)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]naphthalene-1-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(C(=O)/C=C(/c2cc(Cl)cc(Cl)c2)C(F)(F)F)c2ccccc12)NCC(F)(F)F |
| InChI | InChI=1S/C25H16Cl2F6N2O3/c26-14-7-13(8-15(27)9-14)20(25(31,32)33)10-21(36)18-5-6-19(17-4-2-1-3-16(17)18)23(38)34-11-22(37)35-12-24(28,29)30/h1-10H,11-12H2,(H,34,38)(H,35,37)/b20-10- |
| InChIKey | KILMGHXSFAGQIZ-JMIUGGIZSA-N |
| XLogP | 6.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.31 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|