C23H20Cl2F3NO3 — CID 159265661
4-[4-[3-(3,5-dichlorophenyl)but-2-enoyl]-2-methylphenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 159265661) has the molecular formula C23H20Cl2F3NO3 and a molecular weight of 486.32 g/mol. Its IUPAC name is 4-[4-[3-(3,5-dichlorophenyl)but-2-enoyl]-2-methylphenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4-[4-[3-(3,5-dichlorophenyl)but-2-enoyl]-2-methylphenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 159265661 |
| Molecular Formula | C23H20Cl2F3NO3 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 4-[4-[3-(3,5-dichlorophenyl)but-2-enoyl]-2-methylphenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CC(=CC(=O)c1ccc(C(=O)CCC(=O)NCC(F)(F)F)c(C)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H20Cl2F3NO3/c1-13(16-9-17(24)11-18(25)10-16)8-21(31)15-3-4-19(14(2)7-15)20(30)5-6-22(32)29-12-23(26,27)28/h3-4,7-11H,5-6,12H2,1-2H3,(H,29,32) |
| InChIKey | KXBIRQMTNQSNES-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|