C14H19ClN2O2 — CID 119629074
N-(2-amino-2-methylpropyl)-4-(4-chlorophenyl)-4-oxobutanamide (PubChem CID 119629074) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-4-(4-chlorophenyl)-4-oxobutanamide.
| Compound Name | N-(2-amino-2-methylpropyl)-4-(4-chlorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 119629074 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-4-(4-chlorophenyl)-4-oxobutanamide |
| SMILES | CC(C)(N)CNC(=O)CCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O2/c1-14(2,16)9-17-13(19)8-7-12(18)10-3-5-11(15)6-4-10/h3-6H,7-9,16H2,1-2H3,(H,17,19) |
| InChIKey | XCKWNGKXXAZBSX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |