C12H17ClN2O3S — CID 119630251
N-(2-amino-2-methylpropyl)-2-(4-chlorophenyl)sulfonylacetamide (PubChem CID 119630251) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2-(4-chlorophenyl)sulfonylacetamide.
| Compound Name | N-(2-amino-2-methylpropyl)-2-(4-chlorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 119630251 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2-(4-chlorophenyl)sulfonylacetamide |
| SMILES | CC(C)(N)CNC(=O)CS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H17ClN2O3S/c1-12(2,14)8-15-11(16)7-19(17,18)10-5-3-9(13)4-6-10/h3-6H,7-8,14H2,1-2H3,(H,15,16) |
| InChIKey | FTXUEQMLGBGLNE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |