C11H16Cl2N2O3S — CID 119408635
N-(3-aminopropyl)-2-(4-chlorophenyl)sulfonylacetamide;hydrochloride (PubChem CID 119408635) has the molecular formula C11H16Cl2N2O3S and a molecular weight of 327.23 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(4-chlorophenyl)sulfonylacetamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-(4-chlorophenyl)sulfonylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119408635 |
| Molecular Formula | C11H16Cl2N2O3S |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N-(3-aminopropyl)-2-(4-chlorophenyl)sulfonylacetamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)CS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15ClN2O3S.ClH/c12-9-2-4-10(5-3-9)18(16,17)8-11(15)14-7-1-6-13;/h2-5H,1,6-8,13H2,(H,14,15);1H |
| InChIKey | LXKYFXZXYPUFNI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|