C23H20Cl2F6N2O3 — CID 123769444
4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-methylbutanoyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide (PubChem CID 123769444) has the molecular formula C23H20Cl2F6N2O3 and a molecular weight of 557.32 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-methylbutanoyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide.
| Compound Name | 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-methylbutanoyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 123769444 |
| Molecular Formula | C23H20Cl2F6N2O3 |
| Molecular Weight | 557.32 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-methylbutanoyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| SMILES | Cc1cc(C(=O)CC(C)(c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1C(=O)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C23H20Cl2F6N2O3/c1-12-5-13(3-4-17(12)20(36)32-10-19(35)33-11-22(26,27)28)18(34)9-21(2,23(29,30)31)14-6-15(24)8-16(25)7-14/h3-8H,9-11H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | OSNUADOSTRAPEW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |