C25H29F6N3O3 — CID 172967268
2-[[[4-[(E)-C-[2-(3,5-dimethylphenyl)-3,3,3-trifluoro-2-methylpropyl]-N-hydroxycarbonimidoyl]-2-methylphenyl]-hydroxymethyl]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 172967268) has the molecular formula C25H29F6N3O3 and a molecular weight of 533.51 g/mol. Its IUPAC name is 2-[[[4-[(E)-C-[2-(3,5-dimethylphenyl)-3,3,3-trifluoro-2-methylpropyl]-N-hydroxycarbonimidoyl]-2-methylphenyl]-hydroxymethyl]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[[4-[(E)-C-[2-(3,5-dimethylphenyl)-3,3,3-trifluoro-2-methylpropyl]-N-hydroxycarbonimidoyl]-2-methylphenyl]-hydroxymethyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 172967268 |
| Molecular Formula | C25H29F6N3O3 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 2-[[[4-[(E)-C-[2-(3,5-dimethylphenyl)-3,3,3-trifluoro-2-methylpropyl]-N-hydroxycarbonimidoyl]-2-methylphenyl]-hydroxymethyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Cc1cc(C)cc(C(C)(C/C(=N\O)c2ccc(C(O)NCC(=O)NCC(F)(F)F)c(C)c2)C(F)(F)F)c1 |
| InChI | InChI=1S/C25H29F6N3O3/c1-14-7-15(2)9-18(8-14)23(4,25(29,30)31)11-20(34-37)17-5-6-19(16(3)10-17)22(36)32-12-21(35)33-13-24(26,27)28/h5-10,22,32,36-37H,11-13H2,1-4H3,(H,33,35)/b34-20+ |
| InChIKey | WEXPWTUPQQRZBV-QXUDOOCXSA-N |
| XLogP | 4.96 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|