C13H14F3N3O3 — CID 170943873
4-[(E)-hydroxyiminomethyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide (PubChem CID 170943873) has the molecular formula C13H14F3N3O3 and a molecular weight of 317.27 g/mol. Its IUPAC name is 4-[(E)-hydroxyiminomethyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide.
| Compound Name | 4-[(E)-hydroxyiminomethyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 170943873 |
| Molecular Formula | C13H14F3N3O3 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-[(E)-hydroxyiminomethyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| SMILES | Cc1cc(/C=N/O)ccc1C(=O)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C13H14F3N3O3/c1-8-4-9(5-19-22)2-3-10(8)12(21)17-6-11(20)18-7-13(14,15)16/h2-5,22H,6-7H2,1H3,(H,17,21)(H,18,20)/b19-5+ |
| InChIKey | NRQWSJIRDVDQHN-PTXOJBNSSA-N |
| XLogP | 1.21 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|