C22H16Cl3F6N3O2S — CID 89444634
2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzamide (PubChem CID 89444634) has the molecular formula C22H16Cl3F6N3O2S and a molecular weight of 606.80 g/mol. Its IUPAC name is 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzamide.
| Compound Name | 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 89444634 |
| Molecular Formula | C22H16Cl3F6N3O2S |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 604.99 |
| IUPAC Name | 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzamide |
| SMILES | Cc1cc(C2=NSC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C22H16Cl3F6N3O2S/c1-10-4-11(2-3-13(10)19(36)32-8-17(35)33-9-21(26,27)28)16-7-20(37-34-16,22(29,30)31)12-5-14(23)18(25)15(24)6-12/h2-6H,7-9H2,1H3,(H,32,36)(H,33,35) |
| InChIKey | UKZMCLAOWAFUDD-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|