C22H20Cl2F3NO2S — CID 89444682
butyl 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-methylbenzoate (PubChem CID 89444682) has the molecular formula C22H20Cl2F3NO2S and a molecular weight of 490.37 g/mol. Its IUPAC name is butyl 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-methylbenzoate.
| Compound Name | butyl 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 89444682 |
| Molecular Formula | C22H20Cl2F3NO2S |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | butyl 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-methylbenzoate |
| SMILES | CCCCOC(=O)c1ccc(C2=NSC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C22H20Cl2F3NO2S/c1-3-4-7-30-20(29)18-6-5-14(8-13(18)2)19-12-21(31-28-19,22(25,26)27)15-9-16(23)11-17(24)10-15/h5-6,8-11H,3-4,7,12H2,1-2H3 |
| InChIKey | JGHFTRIYYORIKC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|