C20H14Cl3F3N2O2S — CID 90021681
[5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]carbamic acid (PubChem CID 90021681) has the molecular formula C20H14Cl3F3N2O2S and a molecular weight of 509.76 g/mol. Its IUPAC name is [5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]carbamic acid.
| Compound Name | [5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]carbamic acid |
|---|---|
| PubChem CID | 90021681 |
| Molecular Formula | C20H14Cl3F3N2O2S |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | [5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]carbamic acid |
| SMILES | O=C(O)NC1CCc2cc(C3=NSC(c4cc(Cl)c(Cl)c(Cl)c4)(C(F)(F)F)C3)ccc21 |
| InChI | InChI=1S/C20H14Cl3F3N2O2S/c21-13-6-11(7-14(22)17(13)23)19(20(24,25)26)8-16(28-31-19)10-1-3-12-9(5-10)2-4-15(12)27-18(29)30/h1,3,5-7,15,27H,2,4,8H2,(H,29,30) |
| InChIKey | CZPIYKIQLRDJCW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|