C21H14Cl3F3N4OS2 — CID 87055490
3-methyl-N-(pyrimidin-4-ylmethyl)-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]thiophene-2-carboxamide (PubChem CID 87055490) has the molecular formula C21H14Cl3F3N4OS2 and a molecular weight of 565.86 g/mol. Its IUPAC name is 3-methyl-N-(pyrimidin-4-ylmethyl)-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]thiophene-2-carboxamide.
| Compound Name | 3-methyl-N-(pyrimidin-4-ylmethyl)-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 87055490 |
| Molecular Formula | C21H14Cl3F3N4OS2 |
| Molecular Weight | 565.86 g/mol |
| Exact Mass | 563.96 |
| IUPAC Name | 3-methyl-N-(pyrimidin-4-ylmethyl)-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C2=NSC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)sc1C(=O)NCc1ccncn1 |
| InChI | InChI=1S/C21H14Cl3F3N4OS2/c1-10-4-16(33-18(10)19(32)29-8-12-2-3-28-9-30-12)15-7-20(34-31-15,21(25,26)27)11-5-13(22)17(24)14(23)6-11/h2-6,9H,7-8H2,1H3,(H,29,32) |
| InChIKey | VCXLALMJVZMLAP-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.86 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|