C15H25N3O — CID 130266047
2,2,5,5-tetramethyl-N-(pyrimidin-4-ylmethyl)hexanamide (PubChem CID 130266047) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-(pyrimidin-4-ylmethyl)hexanamide.
| Compound Name | 2,2,5,5-tetramethyl-N-(pyrimidin-4-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 130266047 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-(pyrimidin-4-ylmethyl)hexanamide |
| SMILES | CC(C)(C)CCC(C)(C)C(=O)NCc1ccncn1 |
| InChI | InChI=1S/C15H25N3O/c1-14(2,3)7-8-15(4,5)13(19)17-10-12-6-9-16-11-18-12/h6,9,11H,7-8,10H2,1-5H3,(H,17,19) |
| InChIKey | IZGFTWSCGHUAAA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |