C26H25Cl3F3N3O2S — CID 90646280
4-[2-ethyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzoyl]-1-propan-2-ylpiperazin-2-one (PubChem CID 90646280) has the molecular formula C26H25Cl3F3N3O2S and a molecular weight of 606.93 g/mol. Its IUPAC name is 4-[2-ethyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzoyl]-1-propan-2-ylpiperazin-2-one.
| Compound Name | 4-[2-ethyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzoyl]-1-propan-2-ylpiperazin-2-one |
|---|---|
| PubChem CID | 90646280 |
| Molecular Formula | C26H25Cl3F3N3O2S |
| Molecular Weight | 606.93 g/mol |
| Exact Mass | 605.07 |
| IUPAC Name | 4-[2-ethyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzoyl]-1-propan-2-ylpiperazin-2-one |
| SMILES | CCc1cc(C2=NSC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)N1CCN(C(C)C)C(=O)C1 |
| InChI | InChI=1S/C26H25Cl3F3N3O2S/c1-4-15-9-16(5-6-18(15)24(37)34-7-8-35(14(2)3)22(36)13-34)21-12-25(38-33-21,26(30,31)32)17-10-19(27)23(29)20(28)11-17/h5-6,9-11,14H,4,7-8,12-13H2,1-3H3 |
| InChIKey | VPSAGCUHBOBPGY-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.93 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|