C22H14ClF8N3O2S — CID 90646372
1-[2-[4-[5-(4-chloro-3,5-difluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-fluorobenzoyl]diazetidin-1-yl]-3,3-difluoropropan-1-one (PubChem CID 90646372) has the molecular formula C22H14ClF8N3O2S and a molecular weight of 571.88 g/mol. Its IUPAC name is 1-[2-[4-[5-(4-chloro-3,5-difluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-fluorobenzoyl]diazetidin-1-yl]-3,3-difluoropropan-1-one.
| Compound Name | 1-[2-[4-[5-(4-chloro-3,5-difluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-fluorobenzoyl]diazetidin-1-yl]-3,3-difluoropropan-1-one |
|---|---|
| PubChem CID | 90646372 |
| Molecular Formula | C22H14ClF8N3O2S |
| Molecular Weight | 571.88 g/mol |
| Exact Mass | 571.04 |
| IUPAC Name | 1-[2-[4-[5-(4-chloro-3,5-difluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-fluorobenzoyl]diazetidin-1-yl]-3,3-difluoropropan-1-one |
| SMILES | O=C(CC(F)F)N1CCN1C(=O)c1ccc(C2=NSC(c3cc(F)c(Cl)c(F)c3)(C(F)(F)F)C2)cc1F |
| InChI | InChI=1S/C22H14ClF8N3O2S/c23-19-14(25)6-11(7-15(19)26)21(22(29,30)31)9-16(32-37-21)10-1-2-12(13(24)5-10)20(36)34-4-3-33(34)18(35)8-17(27)28/h1-2,5-7,17H,3-4,8-9H2 |
| InChIKey | FXQBJQVNQOXBAC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.88 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|