C23H17Cl2F4N3O3S — CID 146623244
5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-N-ethyl-3-oxospiro[2-benzofuran-1,3'-azetidine]-1'-carboxamide (PubChem CID 146623244) has the molecular formula C23H17Cl2F4N3O3S and a molecular weight of 562.37 g/mol. Its IUPAC name is 5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-N-ethyl-3-oxospiro[2-benzofuran-1,3'-azetidine]-1'-carboxamide.
| Compound Name | 5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-N-ethyl-3-oxospiro[2-benzofuran-1,3'-azetidine]-1'-carboxamide |
|---|---|
| PubChem CID | 146623244 |
| Molecular Formula | C23H17Cl2F4N3O3S |
| Molecular Weight | 562.37 g/mol |
| Exact Mass | 561.03 |
| IUPAC Name | 5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-N-ethyl-3-oxospiro[2-benzofuran-1,3'-azetidine]-1'-carboxamide |
| SMILES | CCNC(=O)N1CC2(C1)OC(=O)c1cc(C3=NSC(c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)ccc12 |
| InChI | InChI=1S/C23H17Cl2F4N3O3S/c1-2-30-20(34)32-9-21(10-32)14-4-3-11(5-13(14)19(33)35-21)17-8-22(36-31-17,23(27,28)29)12-6-15(24)18(26)16(25)7-12/h3-7H,2,8-10H2,1H3,(H,30,34) |
| InChIKey | SRIUWYHWQXYNKX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.37 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|