C22H16Cl2F5N3O2S — CID 139474047
6-[5-(3,5-dichloro-4-fluorophenyl)-5-fluoro-4H-1,2-thiazol-3-yl]-N-(2,2,2-trifluoroethyl)spiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxamide (PubChem CID 139474047) has the molecular formula C22H16Cl2F5N3O2S and a molecular weight of 552.35 g/mol. Its IUPAC name is 6-[5-(3,5-dichloro-4-fluorophenyl)-5-fluoro-4H-1,2-thiazol-3-yl]-N-(2,2,2-trifluoroethyl)spiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxamide.
| Compound Name | 6-[5-(3,5-dichloro-4-fluorophenyl)-5-fluoro-4H-1,2-thiazol-3-yl]-N-(2,2,2-trifluoroethyl)spiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxamide |
|---|---|
| PubChem CID | 139474047 |
| Molecular Formula | C22H16Cl2F5N3O2S |
| Molecular Weight | 552.35 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | 6-[5-(3,5-dichloro-4-fluorophenyl)-5-fluoro-4H-1,2-thiazol-3-yl]-N-(2,2,2-trifluoroethyl)spiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxamide |
| SMILES | O=C(NCC(F)(F)F)N1CC2(C1)OCc1cc(C3=NSC(F)(c4cc(Cl)c(F)c(Cl)c4)C3)ccc12 |
| InChI | InChI=1S/C22H16Cl2F5N3O2S/c23-15-4-13(5-16(24)18(15)25)21(26)6-17(31-35-21)11-1-2-14-12(3-11)7-34-20(14)9-32(10-20)19(33)30-8-22(27,28)29/h1-5H,6-10H2,(H,30,33) |
| InChIKey | LPOXFDMKLFPHPU-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.35 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|