C21H14Cl2F4N2O4 — CID 118259707
1-[6-[5-(3,5-dichloro-4-fluorophenyl)-5-methyl-1,4,2-dioxazol-3-yl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-yl]-2,2,2-trifluoroethanone (PubChem CID 118259707) has the molecular formula C21H14Cl2F4N2O4 and a molecular weight of 505.25 g/mol. Its IUPAC name is 1-[6-[5-(3,5-dichloro-4-fluorophenyl)-5-methyl-1,4,2-dioxazol-3-yl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[6-[5-(3,5-dichloro-4-fluorophenyl)-5-methyl-1,4,2-dioxazol-3-yl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 118259707 |
| Molecular Formula | C21H14Cl2F4N2O4 |
| Molecular Weight | 505.25 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 1-[6-[5-(3,5-dichloro-4-fluorophenyl)-5-methyl-1,4,2-dioxazol-3-yl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1(c2cc(Cl)c(F)c(Cl)c2)ON=C(c2ccc3c(c2)COC32CN(C(=O)C(F)(F)F)C2)O1 |
| InChI | InChI=1S/C21H14Cl2F4N2O4/c1-19(12-5-14(22)16(24)15(23)6-12)32-17(28-33-19)10-2-3-13-11(4-10)7-31-20(13)8-29(9-20)18(30)21(25,26)27/h2-6H,7-9H2,1H3 |
| InChIKey | QSISFFHDWASSDU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|