C11H10BrF3N2O2 — CID 47102738
4-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide (PubChem CID 47102738) has the molecular formula C11H10BrF3N2O2 and a molecular weight of 339.11 g/mol. Its IUPAC name is 4-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 47102738 |
| Molecular Formula | C11H10BrF3N2O2 |
| Molecular Weight | 339.11 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 4-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)cc1)NCC(F)(F)F |
| InChI | InChI=1S/C11H10BrF3N2O2/c12-8-3-1-7(2-4-8)10(19)16-5-9(18)17-6-11(13,14)15/h1-4H,5-6H2,(H,16,19)(H,17,18) |
| InChIKey | XCMLAESRVCXOMN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.11 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |