C21H18Cl2F3NO2S2 — CID 89444270
4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-sulfanylbutanoyl]-2-methyl-N-(thietan-3-yl)benzamide (PubChem CID 89444270) has the molecular formula C21H18Cl2F3NO2S2 and a molecular weight of 508.41 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-sulfanylbutanoyl]-2-methyl-N-(thietan-3-yl)benzamide.
| Compound Name | 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-sulfanylbutanoyl]-2-methyl-N-(thietan-3-yl)benzamide |
|---|---|
| PubChem CID | 89444270 |
| Molecular Formula | C21H18Cl2F3NO2S2 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-sulfanylbutanoyl]-2-methyl-N-(thietan-3-yl)benzamide |
| SMILES | Cc1cc(C(=O)CC(S)(c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1C(=O)NC1CSC1 |
| InChI | InChI=1S/C21H18Cl2F3NO2S2/c1-11-4-12(2-3-17(11)19(29)27-16-9-31-10-16)18(28)8-20(30,21(24,25)26)13-5-14(22)7-15(23)6-13/h2-7,16,30H,8-10H2,1H3,(H,27,29) |
| InChIKey | XRDPGFYPQREZGX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|