C23H18Cl2F5N3O3S — CID 87233109
4-[5-(3,5-dichlorophenyl)-4-(2,2-difluoroethoxyimino)-5-(trifluoromethyl)-1,2-oxazol-3-yl]-2-methyl-N-(thietan-3-yl)benzamide (PubChem CID 87233109) has the molecular formula C23H18Cl2F5N3O3S and a molecular weight of 582.38 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-4-(2,2-difluoroethoxyimino)-5-(trifluoromethyl)-1,2-oxazol-3-yl]-2-methyl-N-(thietan-3-yl)benzamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-4-(2,2-difluoroethoxyimino)-5-(trifluoromethyl)-1,2-oxazol-3-yl]-2-methyl-N-(thietan-3-yl)benzamide |
|---|---|
| PubChem CID | 87233109 |
| Molecular Formula | C23H18Cl2F5N3O3S |
| Molecular Weight | 582.38 g/mol |
| Exact Mass | 581.04 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-4-(2,2-difluoroethoxyimino)-5-(trifluoromethyl)-1,2-oxazol-3-yl]-2-methyl-N-(thietan-3-yl)benzamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2=NOCC(F)F)ccc1C(=O)NC1CSC1 |
| InChI | InChI=1S/C23H18Cl2F5N3O3S/c1-11-4-12(2-3-17(11)21(34)31-16-9-37-10-16)19-20(33-35-8-18(26)27)22(36-32-19,23(28,29)30)13-5-14(24)7-15(25)6-13/h2-7,16,18H,8-10H2,1H3,(H,31,34) |
| InChIKey | VIMGKTVNZQKRRB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.38 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|