C17H12BrCl2F3OS — CID 89444584
1-(4-bromo-3-methylphenyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-sulfanylbutan-1-one (PubChem CID 89444584) has the molecular formula C17H12BrCl2F3OS and a molecular weight of 472.15 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-sulfanylbutan-1-one.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-sulfanylbutan-1-one |
|---|---|
| PubChem CID | 89444584 |
| Molecular Formula | C17H12BrCl2F3OS |
| Molecular Weight | 472.15 g/mol |
| Exact Mass | 469.91 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-sulfanylbutan-1-one |
| SMILES | Cc1cc(C(=O)CC(S)(c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C17H12BrCl2F3OS/c1-9-4-10(2-3-14(9)18)15(24)8-16(25,17(21,22)23)11-5-12(19)7-13(20)6-11/h2-7,25H,8H2,1H3 |
| InChIKey | FWTUEFIPNIBFFD-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.15 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|