C24H14Cl2F7N3O3 — CID 149003931
4-N-[1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethylidene]-1-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]naphthalene-1,4-dicarboxamide (PubChem CID 149003931) has the molecular formula C24H14Cl2F7N3O3 and a molecular weight of 596.29 g/mol. Its IUPAC name is 4-N-[1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethylidene]-1-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]naphthalene-1,4-dicarboxamide.
| Compound Name | 4-N-[1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethylidene]-1-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]naphthalene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 149003931 |
| Molecular Formula | C24H14Cl2F7N3O3 |
| Molecular Weight | 596.29 g/mol |
| Exact Mass | 595.03 |
| IUPAC Name | 4-N-[1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethylidene]-1-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]naphthalene-1,4-dicarboxamide |
| SMILES | O=C(CNC(=O)c1ccc(C(=O)/N=C(/c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)c2ccccc12)NCC(F)(F)F |
| InChI | InChI=1S/C24H14Cl2F7N3O3/c25-16-7-11(8-17(26)19(16)27)20(24(31,32)33)36-22(39)15-6-5-14(12-3-1-2-4-13(12)15)21(38)34-9-18(37)35-10-23(28,29)30/h1-8H,9-10H2,(H,34,38)(H,35,37)/b36-20- |
| InChIKey | QAEXFLGNKGUPOF-QJOVZPHJSA-N |
| XLogP | 5.89 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.29 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|