C11H12F3NO2S — CID 55180135
3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pentanoic acid (PubChem CID 55180135) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is 3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pentanoic acid.
| Compound Name | 3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 55180135 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H12F3NO2S/c1-2-8(5-10(16)17)18-9-4-3-7(6-15-9)11(12,13)14/h3-4,6,8H,2,5H2,1H3,(H,16,17) |
| InChIKey | PYEDYMLYNXOHMW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |