C10H10F3NO4 — CID 171878081
3,4-dihydroxy-4-[5-(trifluoromethyl)-2-pyridinyl]butanoic acid (PubChem CID 171878081) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is 3,4-dihydroxy-4-[5-(trifluoromethyl)-2-pyridinyl]butanoic acid.
| Compound Name | 3,4-dihydroxy-4-[5-(trifluoromethyl)-2-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 171878081 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3,4-dihydroxy-4-[5-(trifluoromethyl)-2-pyridinyl]butanoic acid |
| SMILES | O=C(O)CC(O)C(O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H10F3NO4/c11-10(12,13)5-1-2-6(14-4-5)9(18)7(15)3-8(16)17/h1-2,4,7,9,15,18H,3H2,(H,16,17) |
| InChIKey | RDIVFJICNVIEPV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |