C12H13F3N2OS — CID 95900158
(2R)-N-cyclopropyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanamide (PubChem CID 95900158) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanamide.
| Compound Name | (2R)-N-cyclopropyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 95900158 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (2R)-N-cyclopropyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1ccc(C(F)(F)F)cn1)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H13F3N2OS/c1-7(11(18)17-9-3-4-9)19-10-5-2-8(6-16-10)12(13,14)15/h2,5-7,9H,3-4H2,1H3,(H,17,18)/t7-/m1/s1 |
| InChIKey | UCYJCKXWXCENGB-SSDOTTSWSA-N |
| XLogP | 2.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |