C20H24F3N3O2S — CID 43027459
N-(1-adamantylcarbamoyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanamide (PubChem CID 43027459) has the molecular formula C20H24F3N3O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-(1-adamantylcarbamoyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanamide.
| Compound Name | N-(1-adamantylcarbamoyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 43027459 |
| Molecular Formula | C20H24F3N3O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-(1-adamantylcarbamoyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanamide |
| SMILES | CC(Sc1ccc(C(F)(F)F)cn1)C(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H24F3N3O2S/c1-11(29-16-3-2-15(10-24-16)20(21,22)23)17(27)25-18(28)26-19-7-12-4-13(8-19)6-14(5-12)9-19/h2-3,10-14H,4-9H2,1H3,(H2,25,26,27,28) |
| InChIKey | GQDIVVZSIPPLKD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |