C16H21F3N2OS — CID 112817234
N-(4-ethylcyclohexyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide (PubChem CID 112817234) has the molecular formula C16H21F3N2OS and a molecular weight of 346.42 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-(4-ethylcyclohexyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 112817234 |
| Molecular Formula | C16H21F3N2OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-(4-ethylcyclohexyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
| SMILES | CCC1CCC(NC(=O)CSc2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H21F3N2OS/c1-2-11-3-6-13(7-4-11)21-14(22)10-23-15-8-5-12(9-20-15)16(17,18)19/h5,8-9,11,13H,2-4,6-7,10H2,1H3,(H,21,22) |
| InChIKey | LFYKGIBFXXBFTL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |