C21H27NO4S — CID 133265218
methyl 5-[1-(4-tert-butylphenyl)ethylsulfamoyl]-2-methylbenzoate (PubChem CID 133265218) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is methyl 5-[1-(4-tert-butylphenyl)ethylsulfamoyl]-2-methylbenzoate.
| Compound Name | methyl 5-[1-(4-tert-butylphenyl)ethylsulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 133265218 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | methyl 5-[1-(4-tert-butylphenyl)ethylsulfamoyl]-2-methylbenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC(C)c2ccc(C(C)(C)C)cc2)ccc1C |
| InChI | InChI=1S/C21H27NO4S/c1-14-7-12-18(13-19(14)20(23)26-6)27(24,25)22-15(2)16-8-10-17(11-9-16)21(3,4)5/h7-13,15,22H,1-6H3 |
| InChIKey | VJMAMOCZDMDPER-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |