C23H23NO4S — CID 100570774
methyl 2-methyl-5-[[(R)-(4-methylphenyl)-phenylmethyl]sulfamoyl]benzoate (PubChem CID 100570774) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is methyl 2-methyl-5-[[(R)-(4-methylphenyl)-phenylmethyl]sulfamoyl]benzoate.
| Compound Name | methyl 2-methyl-5-[[(R)-(4-methylphenyl)-phenylmethyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 100570774 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | methyl 2-methyl-5-[[(R)-(4-methylphenyl)-phenylmethyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N[C@H](c2ccccc2)c2ccc(C)cc2)ccc1C |
| InChI | InChI=1S/C23H23NO4S/c1-16-9-12-19(13-10-16)22(18-7-5-4-6-8-18)24-29(26,27)20-14-11-17(2)21(15-20)23(25)28-3/h4-15,22,24H,1-3H3/t22-/m1/s1 |
| InChIKey | PBJXBSSRWHVIQW-JOCHJYFZSA-N |
| XLogP | 4.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |