C17H19NO4S2 — CID 100695565
methyl 2-methyl-5-(2-phenylsulfanylethylsulfamoyl)benzoate (PubChem CID 100695565) has the molecular formula C17H19NO4S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is methyl 2-methyl-5-(2-phenylsulfanylethylsulfamoyl)benzoate.
| Compound Name | methyl 2-methyl-5-(2-phenylsulfanylethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 100695565 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | methyl 2-methyl-5-(2-phenylsulfanylethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCSc2ccccc2)ccc1C |
| InChI | InChI=1S/C17H19NO4S2/c1-13-8-9-15(12-16(13)17(19)22-2)24(20,21)18-10-11-23-14-6-4-3-5-7-14/h3-9,12,18H,10-11H2,1-2H3 |
| InChIKey | SKQGPYOCBCITHQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|