C28H32N2O4S — CID 43885368
3-(azepane-1-carbonyl)-4-methoxy-N-[(4-methylphenyl)-phenylmethyl]benzenesulfonamide (PubChem CID 43885368) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is 3-(azepane-1-carbonyl)-4-methoxy-N-[(4-methylphenyl)-phenylmethyl]benzenesulfonamide.
| Compound Name | 3-(azepane-1-carbonyl)-4-methoxy-N-[(4-methylphenyl)-phenylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43885368 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 3-(azepane-1-carbonyl)-4-methoxy-N-[(4-methylphenyl)-phenylmethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(c2ccccc2)c2ccc(C)cc2)cc1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C28H32N2O4S/c1-21-12-14-23(15-13-21)27(22-10-6-5-7-11-22)29-35(32,33)24-16-17-26(34-2)25(20-24)28(31)30-18-8-3-4-9-19-30/h5-7,10-17,20,27,29H,3-4,8-9,18-19H2,1-2H3 |
| InChIKey | RRAFNTBHNKMDEA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |