C20H20N2O4S3 — CID 87746324
5-[ethyl-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]sulfamoyl]-2,3-dimethylbenzoic acid (PubChem CID 87746324) has the molecular formula C20H20N2O4S3 and a molecular weight of 448.59 g/mol. Its IUPAC name is 5-[ethyl-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]sulfamoyl]-2,3-dimethylbenzoic acid.
| Compound Name | 5-[ethyl-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]sulfamoyl]-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 87746324 |
| Molecular Formula | C20H20N2O4S3 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 5-[ethyl-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]sulfamoyl]-2,3-dimethylbenzoic acid |
| SMILES | CCN(Sc1nc(-c2ccccc2)cs1)S(=O)(=O)c1cc(C)c(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H20N2O4S3/c1-4-22(28-20-21-18(12-27-20)15-8-6-5-7-9-15)29(25,26)16-10-13(2)14(3)17(11-16)19(23)24/h5-12H,4H2,1-3H3,(H,23,24) |
| InChIKey | NDYPZFHLNARPBL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|