C23H17NO2S — CID 89470594
2-(2-methylphenyl)-5-(4-phenyl-1,3-thiazol-2-yl)benzoic acid (PubChem CID 89470594) has the molecular formula C23H17NO2S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-(2-methylphenyl)-5-(4-phenyl-1,3-thiazol-2-yl)benzoic acid.
| Compound Name | 2-(2-methylphenyl)-5-(4-phenyl-1,3-thiazol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 89470594 |
| Molecular Formula | C23H17NO2S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-(2-methylphenyl)-5-(4-phenyl-1,3-thiazol-2-yl)benzoic acid |
| SMILES | Cc1ccccc1-c1ccc(-c2nc(-c3ccccc3)cs2)cc1C(=O)O |
| InChI | InChI=1S/C23H17NO2S/c1-15-7-5-6-10-18(15)19-12-11-17(13-20(19)23(25)26)22-24-21(14-27-22)16-8-3-2-4-9-16/h2-14H,1H3,(H,25,26) |
| InChIKey | YVDXFZUPKJJBLO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |