C23H17Cl2N2O3S+ — CID 144556950
[2-[2-carboxy-4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]phenyl]-methoxyazanium (PubChem CID 144556950) has the molecular formula C23H17Cl2N2O3S+ and a molecular weight of 472.37 g/mol. Its IUPAC name is [2-[2-carboxy-4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]phenyl]-methoxyazanium.
| Compound Name | [2-[2-carboxy-4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]phenyl]-methoxyazanium |
|---|---|
| PubChem CID | 144556950 |
| Molecular Formula | C23H17Cl2N2O3S+ |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | [2-[2-carboxy-4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]phenyl]-methoxyazanium |
| SMILES | CO[NH2+]c1ccccc1-c1ccc(-c2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1C(=O)O |
| InChI | InChI=1S/C23H16Cl2N2O3S/c1-30-27-20-5-3-2-4-16(20)15-8-6-14(10-17(15)23(28)29)22-26-21(12-31-22)13-7-9-18(24)19(25)11-13/h2-12,27H,1H3,(H,28,29)/p+1 |
| InChIKey | NRDNHHUEXVNDEL-UHFFFAOYSA-O |
| XLogP | 5.91 |
| TPSA | 76.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|