C18H19NO3S3 — CID 87614230
4-ethylbenzenesulfonic acid;2-methylsulfanyl-4-phenyl-1,3-thiazole (PubChem CID 87614230) has the molecular formula C18H19NO3S3 and a molecular weight of 393.56 g/mol. Its IUPAC name is 4-ethylbenzenesulfonic acid;2-methylsulfanyl-4-phenyl-1,3-thiazole.
| Compound Name | 4-ethylbenzenesulfonic acid;2-methylsulfanyl-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 87614230 |
| Molecular Formula | C18H19NO3S3 |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 4-ethylbenzenesulfonic acid;2-methylsulfanyl-4-phenyl-1,3-thiazole |
| SMILES | CCc1ccc(S(=O)(=O)O)cc1.CSc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C10H9NS2.C8H10O3S/c1-12-10-11-9(7-13-10)8-5-3-2-4-6-8;1-2-7-3-5-8(6-4-7)12(9,10)11/h2-7H,1H3;3-6H,2H2,1H3,(H,9,10,11) |
| InChIKey | XBCDEROOIIJOFZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|