C16H13NOS2 — CID 21435671
2-methylsulfanyl-4-(4-phenoxyphenyl)-1,3-thiazole (PubChem CID 21435671) has the molecular formula C16H13NOS2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-methylsulfanyl-4-(4-phenoxyphenyl)-1,3-thiazole.
| Compound Name | 2-methylsulfanyl-4-(4-phenoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 21435671 |
| Molecular Formula | C16H13NOS2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-methylsulfanyl-4-(4-phenoxyphenyl)-1,3-thiazole |
| SMILES | CSc1nc(-c2ccc(Oc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C16H13NOS2/c1-19-16-17-15(11-20-16)12-7-9-14(10-8-12)18-13-5-3-2-4-6-13/h2-11H,1H3 |
| InChIKey | GFCKVKRJDHZKQX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |