C19H14N2OS — CID 3588152
4-(4-phenoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole (PubChem CID 3588152) has the molecular formula C19H14N2OS and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-(4-phenoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole.
| Compound Name | 4-(4-phenoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 3588152 |
| Molecular Formula | C19H14N2OS |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-(4-phenoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole |
| SMILES | c1ccc(Oc2ccc(-c3csc(-n4cccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C19H14N2OS/c1-2-6-16(7-3-1)22-17-10-8-15(9-11-17)18-14-23-19(20-18)21-12-4-5-13-21/h1-14H |
| InChIKey | VKIUDVYPXFVZLB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |