C17H9BrN2O2S — CID 3520878
2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione (PubChem CID 3520878) has the molecular formula C17H9BrN2O2S and a molecular weight of 385.24 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3520878 |
| Molecular Formula | C17H9BrN2O2S |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C17H9BrN2O2S/c18-11-7-5-10(6-8-11)14-9-23-17(19-14)20-15(21)12-3-1-2-4-13(12)16(20)22/h1-9H |
| InChIKey | ZZZCDAJBCSADKT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|