C17H10N2O2S — CID 168519133
2-[4-(1,3-thiazol-4-yl)phenyl]isoindole-1,3-dione (PubChem CID 168519133) has the molecular formula C17H10N2O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-[4-(1,3-thiazol-4-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(1,3-thiazol-4-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168519133 |
| Molecular Formula | C17H10N2O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[4-(1,3-thiazol-4-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(-c2cscn2)cc1 |
| InChI | InChI=1S/C17H10N2O2S/c20-16-13-3-1-2-4-14(13)17(21)19(16)12-7-5-11(6-8-12)15-9-22-10-18-15/h1-10H |
| InChIKey | XKZJMRATNIRLTG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|