C27H20N2O3S — CID 46534757
(4Z)-2-(4-methylphenyl)-4-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]isoquinoline-1,3-dione (PubChem CID 46534757) has the molecular formula C27H20N2O3S and a molecular weight of 452.54 g/mol. Its IUPAC name is (4Z)-2-(4-methylphenyl)-4-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]isoquinoline-1,3-dione.
| Compound Name | (4Z)-2-(4-methylphenyl)-4-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 46534757 |
| Molecular Formula | C27H20N2O3S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (4Z)-2-(4-methylphenyl)-4-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]isoquinoline-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3ccc(OCc4cscn4)cc3)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C27H20N2O3S/c1-18-6-10-21(11-7-18)29-26(30)24-5-3-2-4-23(24)25(27(29)31)14-19-8-12-22(13-9-19)32-15-20-16-33-17-28-20/h2-14,16-17H,15H2,1H3/b25-14- |
| InChIKey | JYMHKVYAXLVHOC-QFEZKATASA-N |
| XLogP | 5.76 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|