C20H12Cl2N2O2S — CID 2416689
(4E)-4-[(2,4-dichloro-1,3-thiazol-5-yl)methylidene]-2-(4-methylphenyl)isoquinoline-1,3-dione (PubChem CID 2416689) has the molecular formula C20H12Cl2N2O2S and a molecular weight of 415.30 g/mol. Its IUPAC name is (4E)-4-[(2,4-dichloro-1,3-thiazol-5-yl)methylidene]-2-(4-methylphenyl)isoquinoline-1,3-dione.
| Compound Name | (4E)-4-[(2,4-dichloro-1,3-thiazol-5-yl)methylidene]-2-(4-methylphenyl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2416689 |
| Molecular Formula | C20H12Cl2N2O2S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | (4E)-4-[(2,4-dichloro-1,3-thiazol-5-yl)methylidene]-2-(4-methylphenyl)isoquinoline-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3sc(Cl)nc3Cl)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H12Cl2N2O2S/c1-11-6-8-12(9-7-11)24-18(25)14-5-3-2-4-13(14)15(19(24)26)10-16-17(21)23-20(22)27-16/h2-10H,1H3/b15-10+ |
| InChIKey | PQIJHZKODQAEPY-XNTDXEJSSA-N |
| XLogP | 5.49 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|