C23H26N3O2+ — CID 7008418
4-[(4-ethylpiperazin-4-ium-1-yl)methylidene]-2-(4-methylphenyl)isoquinoline-1,3-dione (PubChem CID 7008418) has the molecular formula C23H26N3O2+ and a molecular weight of 376.48 g/mol. Its IUPAC name is 4-[(4-ethylpiperazin-4-ium-1-yl)methylidene]-2-(4-methylphenyl)isoquinoline-1,3-dione.
| Compound Name | 4-[(4-ethylpiperazin-4-ium-1-yl)methylidene]-2-(4-methylphenyl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7008418 |
| Molecular Formula | C23H26N3O2+ |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4-[(4-ethylpiperazin-4-ium-1-yl)methylidene]-2-(4-methylphenyl)isoquinoline-1,3-dione |
| SMILES | CC[NH+]1CCN(C=C2C(=O)N(c3ccc(C)cc3)C(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C23H25N3O2/c1-3-24-12-14-25(15-13-24)16-21-19-6-4-5-7-20(19)22(27)26(23(21)28)18-10-8-17(2)9-11-18/h4-11,16H,3,12-15H2,1-2H3/p+1 |
| InChIKey | PRECDNBOCCOKJD-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|