C26H25N4O3+ — CID 2485513
(4Z)-2-(4-methoxyphenyl)-4-[(4-pyridin-1-ium-2-ylpiperazin-1-yl)methylidene]isoquinoline-1,3-dione (PubChem CID 2485513) has the molecular formula C26H25N4O3+ and a molecular weight of 441.51 g/mol. Its IUPAC name is (4Z)-2-(4-methoxyphenyl)-4-[(4-pyridin-1-ium-2-ylpiperazin-1-yl)methylidene]isoquinoline-1,3-dione.
| Compound Name | (4Z)-2-(4-methoxyphenyl)-4-[(4-pyridin-1-ium-2-ylpiperazin-1-yl)methylidene]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2485513 |
| Molecular Formula | C26H25N4O3+ |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (4Z)-2-(4-methoxyphenyl)-4-[(4-pyridin-1-ium-2-ylpiperazin-1-yl)methylidene]isoquinoline-1,3-dione |
| SMILES | COc1ccc(N2C(=O)/C(=C\N3CCN(c4cccc[nH+]4)CC3)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H24N4O3/c1-33-20-11-9-19(10-12-20)30-25(31)22-7-3-2-6-21(22)23(26(30)32)18-28-14-16-29(17-15-28)24-8-4-5-13-27-24/h2-13,18H,14-17H2,1H3/p+1/b23-18- |
| InChIKey | CTRXGONFMRMYLM-NKFKGCMQSA-O |
| XLogP | 2.86 |
| TPSA | 67.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|