C25H21NO6 — CID 19184538
[4-(1,3-dioxoisoindol-2-yl)phenyl] 4-(4-methoxyphenoxy)butanoate (PubChem CID 19184538) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is [4-(1,3-dioxoisoindol-2-yl)phenyl] 4-(4-methoxyphenoxy)butanoate.
| Compound Name | [4-(1,3-dioxoisoindol-2-yl)phenyl] 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 19184538 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [4-(1,3-dioxoisoindol-2-yl)phenyl] 4-(4-methoxyphenoxy)butanoate |
| SMILES | COc1ccc(OCCCC(=O)Oc2ccc(N3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H21NO6/c1-30-18-12-14-19(15-13-18)31-16-4-7-23(27)32-20-10-8-17(9-11-20)26-24(28)21-5-2-3-6-22(21)25(26)29/h2-3,5-6,8-15H,4,7,16H2,1H3 |
| InChIKey | VQHBOCFRAAWWHW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|