C20H15NO4 — CID 176514543
2-[4-(2-hydroxyethoxy)phenyl]benzo[f]isoindole-1,3-dione (PubChem CID 176514543) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethoxy)phenyl]benzo[f]isoindole-1,3-dione.
| Compound Name | 2-[4-(2-hydroxyethoxy)phenyl]benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 176514543 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[4-(2-hydroxyethoxy)phenyl]benzo[f]isoindole-1,3-dione |
| SMILES | O=C1c2cc3ccccc3cc2C(=O)N1c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C20H15NO4/c22-9-10-25-16-7-5-15(6-8-16)21-19(23)17-11-13-3-1-2-4-14(13)12-18(17)20(21)24/h1-8,11-12,22H,9-10H2 |
| InChIKey | AIUUEJSMEYCKAM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|