C40H40N2O6 — CID 102095160
2-(4-hexoxyphenyl)-5-[2-(4-hexoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione (PubChem CID 102095160) has the molecular formula C40H40N2O6 and a molecular weight of 644.77 g/mol. Its IUPAC name is 2-(4-hexoxyphenyl)-5-[2-(4-hexoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione.
| Compound Name | 2-(4-hexoxyphenyl)-5-[2-(4-hexoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102095160 |
| Molecular Formula | C40H40N2O6 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | 2-(4-hexoxyphenyl)-5-[2-(4-hexoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
| SMILES | CCCCCCOc1ccc(N2C(=O)c3ccc(-c4ccc5c(c4)C(=O)N(c4ccc(OCCCCCC)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C40H40N2O6/c1-3-5-7-9-23-47-31-17-13-29(14-18-31)41-37(43)33-21-11-27(25-35(33)39(41)45)28-12-22-34-36(26-28)40(46)42(38(34)44)30-15-19-32(20-16-30)48-24-10-8-6-4-2/h11-22,25-26H,3-10,23-24H2,1-2H3 |
| InChIKey | ZWMUREVTISUGMP-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|