C30H40FNO4 — CID 57065085
2-(3,5-dioctoxyphenyl)-5-fluoroisoindole-1,3-dione (PubChem CID 57065085) has the molecular formula C30H40FNO4 and a molecular weight of 497.65 g/mol. Its IUPAC name is 2-(3,5-dioctoxyphenyl)-5-fluoroisoindole-1,3-dione.
| Compound Name | 2-(3,5-dioctoxyphenyl)-5-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 57065085 |
| Molecular Formula | C30H40FNO4 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 2-(3,5-dioctoxyphenyl)-5-fluoroisoindole-1,3-dione |
| SMILES | CCCCCCCCOc1cc(OCCCCCCCC)cc(N2C(=O)c3ccc(F)cc3C2=O)c1 |
| InChI | InChI=1S/C30H40FNO4/c1-3-5-7-9-11-13-17-35-25-20-24(21-26(22-25)36-18-14-12-10-8-6-4-2)32-29(33)27-16-15-23(31)19-28(27)30(32)34/h15-16,19-22H,3-14,17-18H2,1-2H3 |
| InChIKey | ZOGCAYWPTHKCEL-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|