C26H27NO3 — CID 4280854
2-(4-octoxyphenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 4280854) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-(4-octoxyphenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(4-octoxyphenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 4280854 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-(4-octoxyphenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCCCOc1ccc(N2C(=O)c3cccc4cccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C26H27NO3/c1-2-3-4-5-6-7-18-30-21-16-14-20(15-17-21)27-25(28)22-12-8-10-19-11-9-13-23(24(19)22)26(27)29/h8-17H,2-7,18H2,1H3 |
| InChIKey | IULCROMGPXOVEZ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|